L-Xylulose - CAS 527-50-4

L-Xylulose is an intermediate in certain metabolic pathways and is classified as a rare sugar. It shows important physiological effects such as acting as an inhibitor of α-glucosidase and decreasing blood glucose, and it can be employed to produce other significant rare sugars, such as L-ribose and L-xylose which contribute to the production of antiviral drugs.

Others, Endogenous Metabolite

Others, Metabolism

473

C5H10O5

150.13

[C@@H]([C@H](CO)O)(C(CO)=O)O

-20°C

Ice Packs

Small Compound