Lentztrehalose B - CAS 1808096-67-4

Lentztrehalose B, a microbial disaccharide metabolite isolated from Lentzea, exhibits a range of biological activities. At a concentration of 100 μM, it demonstrates antioxidant properties in an oxygen radical absorbance capacity (ORAC) assay. Furthermore, Lentztrehalose B at 10 mM inhibits porcine kidney trehalase, an enzyme involved in trehalose metabolism. Additionally, it induces autophagy in MeWo melanoma and OVK18 ovarian cancer cells when applied at 100 mM.

Others, Autophagy

Others, Autophagy

1808096-67-4

C17H30O11

410.41

O(CC=C(C)C)[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O

-20°C

Ice Packs

Natural Product