Liothyronine sodium - CAS 55-06-1

Liothyronine Sodium is the sodium salt form of liothyronine, a synthetic form of the levorotatory isomer of the naturally occurring thyroid hormone triiodothyronine (T3) . Liothyronine sodium (3,3',5-Triiodo-L-thyronine sodium) binds to nuclear thyroid receptors which then bind to thyroid hormone response elements of target genes. As a result, liothyronine sodium induces gene expression that is required for normal growth and development. Liothyronine sodium is more potent and has a more rapid action than thyroxine (T4) .

Endogenous Metabolite, Thyroid hormone receptor (THR)

Endocrinology/Hormones, Metabolism

55-06-1

0.98

C15H11I3NNaO4

672.96

[Na+].N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C([O-])=O

-20°C

Ice Packs

Small Compound