LQB-118 - CAS 1219104-20-7

LQB-118, an orally active compound sourced from sandalwood, demonstrates multiple therapeutic capabilities. It has shown proficiency in inhibiting glioblastoma cell migration and inducing apoptosis. Additionally, LQB-118 can curtail both migration and invasion of prostate cancer cells by modulating the AKT/GSK3β pathway and regulating MMP-9/reck gene expression. The compound is also effective against yeast polysaccharide-induced inflammation in both in vivo and in vitro settings. Notably, LQB-118 specifically triggers ROS-mediated and mitochondrial-dependent apoptosis in Leishmania amazonensis, highlighting its potential in studies focusing on inflammation, infections, and various cancers.

Apoptosis, Reactive Oxygen Species, MMP, GSK-3

Metabolism, Immunology/Inflammation, Apoptosis, Proteases/Proteasome, Stem Cells, PI3K/Akt/mTOR signaling, NF-κB

1219077

C19H12O4

304.3

O=C1C=2[C@@]3([C@@](C=4C(O3)=CC=CC4)(COC2C(=O)C=5C1=CC=CC5)[H])[H]

-20°C

Ice Packs

Small Compound