LX1 - CAS 2647877-84-5

LX1, an anti-prostate cancer compound, specifically targets the androgen receptor (AR), AR variants, and the steroidogenic enzyme AKR1C3. It inhibits AKR1C3's enzymatic function, decreases the conversion of androstenedione to testosterone, and reduces the expression of both AR and AR-V7, subsequently downregulating their target genes. Additionally, LX1 is effective in overcoming tumor cell resistance to Enzalutamide, and when combined with Enzalutamide, it further suppresses tumor growth.

Androgen Receptor, Reductase

Metabolism, Endocrinology/Hormones

2647788

C22H15F6NO2

439.35

O=C(NC=1C=C(C=C(C1)C(F)(F)F)C(F)(F)F)C2=CC(=CC=C2O)CC=3C=CC=CC3

-20°C

Ice Packs

Small Compound