Lys (CO-C3-p-I-Ph) -O-tBu - CAS 2703051-80-1

Lys (CO-C3-p-I-Ph) -O-tBu, a pharmacokinetic modifier (PK modifier), enhances the pharmacokinetic properties of PSMA ligand molecules by increasing their residence time in plasma through improved binding to albumin and reducing absorption by the salivary glands, potentially extending the active compound's half-life. Moreover, Ac-PSMA-trillium is an effective PSMA-targeting compound for various biological applications when modified with different radioactive isotopes. When labeled with 111 In, it serves as a DOTA chelating agent and imaging agent. Alternatively, when labeled with 225 Ac, it acts as a Macropa chelator for targeted radionuclide therapy (TRT) in researching metastatic castration-resistant prostate cancer (mCRPC) [1] [2].

DNA-PK

DNA Damage/DNA Repair, PI3K/Akt/mTOR signaling

2703051-80-1

C20H31IN2O3

474.38

C(CCC(NCCCC[C@@H](C(OC(C)(C)C)=O)N)=O)C1=CC=C(I)C=C1

-20°C

Ice Packs

Small Compound