Lysosomal P-gp targeted agent 1 - CAS 3043797-88-9

Lysosomal P-gp targeted agent 1 (Compound 14) is an antitumor drug that targets lysosomal P-glycoprotein (Pgp) . It is selectively transported to lysosomes via overexpressed Pgp, releasing nitric oxide that generates reactive oxygen species (ROS), causing lysosomal membrane permeabilization (LMP) and inducing apoptosis. This compound can overcome resistance mediated by P-glycoprotein, leading to cell cycle arrest while maintaining relatively low toxicity to normal cells. It exhibits antitumor activity by significantly inhibiting tumor growth.

Apoptosis, Bcl-2 Family, Caspase, Reactive Oxygen Species, P-gp

Membrane transporter/Ion channel, Immunology/Inflammation, Neuroscience, Metabolism, Apoptosis, Proteases/Proteasome, NF-κB

3043700

C39H34N2O9S

706.76

O=N=1ON=C(OCCCOC2=CC=CC3=C2OC4=CC=CC(=C4)CCC5=CC=C(O)C(OC6=CC=C(C=C6)CC3)=C5)C1S(=O)(=O)C=7C=CC=CC7

-20°C

Ice Packs

Small Compound