Malic acid disodium salt - CAS 676-46-0

Sodium DL-Malate is an organic compound commonly used as a food additive, buffering agent, and nutritional supplement. It consists of sodium and malic acid (Malic acid disodium salt) and possesses various properties suited for these applications, such as enhancing food flavor, improving texture, and regulating acidity. Furthermore, it can serve as a dietary supplement due to its potential health benefits, including boosting energy production, reducing fatigue, and enhancing athletic performance.

676-46-0

C4H4Na2O5

178.0511

O=C(CC(C(O[Na])=O)O)O[Na]

-20°C

Ice Packs

Inhibitors & Agonists