Malondialdehyde tetrabutylammonium - CAS 100683-54-3

Malondialdehyde tetrabutylammonium serves as a biomarker with antioxidant properties, and is extensively used in both the food and cosmetics industries primarily for monitoring and assessing product stability and safety. It acts as an indicator of lipid peroxidation, aiding in the evaluation of oxidative stress levels. Additionally, this compound has significant implications for indicating cellular damage and is investigated as a potential biomarker for various diseases.

Others, Endogenous Metabolite

Others, Metabolism

100626

C19H39NO2

313.52

[N+](CCCC)(CCCC)(CCCC)CCCC.C(\C=O)=C/[O-]

-20°C

Ice Packs

Small Compound