MAO A/HSP90-IN-1 - CAS 2927489-95-8

MAO A/HSP90-IN-1 (4-b) is a dual inhibitor of MAO A and HSP90, with IC50 values of 1.77 μM in glioblastoma (GBM) GL26 cells and 0.019 μM against HSP90α. This compound impairs MAO A activity, disrupts HSP90 binding, and downregulates HER2 and phospho-Akt expressions, thus inhibiting GBM growth. Additionally, it reduces PD-L1 expression, thwarting T cell activation and potential tumor immune evasion. MAO A/HSP90-IN-1 (4-b) is valuable for research into brain tumor-related diseases [1].

HSP, Monoamine Oxidase

Cytoskeletal Signaling, Metabolism, Neuroscience

2927386

C24H29ClN2O4

444.95

C(N(C)C1=CC(Cl)=C(OCCCN(CC#C)C)C=C1)(=O)C2=CC(C(C)C)=C(O)C=C2O

-20°C

Ice Packs

Small Compound