Melatonin-d4 - CAS 66521-38-8

Melatonin D5, a deuterium-labeled version of melatonin, is a hormone produced by the pineal gland, known for its role as a selective ATF-6 inhibitor that promotes apoptosis in human hepatoma cells via COX-2 downregulation. Additionally, it activates melatonin receptors and exhibits antioxidative and anti-inflammatory properties.

Apoptosis, Melatonin Receptor, Autophagy, Mitophagy

Apoptosis, Autophagy, GPCR/G Protein

66475

C13H16N2O2

236.3

[2H]C([2H])(NC(C)=O)C([2H])([2H])c1c[nH]c2ccc(OC)cc12

-20°C

Ice Packs

Isotope products