Merulidial - CAS 68053-32-7

Merulidial (Compound 1) is an antibiotic and cytotoxic agent characterized by a sesquiterpene dialdehyde structure. It effectively inhibits the spore germination and mycelial growth of the wood-decaying basidiomycete Heterobasidion annosum (H. annosum) and the saprophytic fungus Cladosporium cucumerinum (C. cucumerinum) . Additionally, Merulidial suppresses DNA synthesis in various bacteria, algae, and ECA cells. It exhibits strong anticancer activity, with IC50 values of 20 μg/mL for ECA cells and 10 μg/mL for L1210 cells.

Antifungal, DNA/RNA Synthesis, Antibiotic, Antibacterial

DNA Damage/DNA Repair, Cell Cycle/Checkpoint, Microbiology/Virology

68053-32-7

C15H20O3

248.32

C(=O)[C@@]12[C@@](C)(C1)[C@@H](O)[C@]3(C(=C2C=O)CC(C)(C)C3)[H]

-20°C

Ice Packs

Natural Product