Methylene Violet 3RAX - CAS 4569-86-2

Methylene Violet 3RAX is a cationic dye, a potential photosensitizer in photodynamic therapy, with antitumor activity that alters the molecular structure of DNA, disrupts the modules of DNA, and induces the production of reactive monoclinic oxygen species, which are used to stain the mitochondria of cells.Methylene Violet 3RAX inhibits the subcellular localization of cancer cells by severing the Methylene Violet 3RAX inhibits subcellular localization of cancer cells, leading to cell death by cutting DNA strands in tumor cells.

Cholinesterase (ChE), Photosensitizer

Neuroscience, Apoptosis

4481

0.9717

C22H23ClN4

378.9

[Cl-].N=1C=2C=CC(N)=CC2[N+](C=3C=CC=CC3)=C4C=C(C=CC14)N(CC)CC

-20°C

Ice Packs

Small Compound