MMAF intermediate 1 - CAS 161485-82-1

MMAFintermediate 1 serves as a precursor in the synthesis of MMAF (Monomethylauristatin F), an effective inhibitor of tubulin polymerization. MMAF is a cytotoxic component commonly used in antibody-drug conjugates (ADCs) such as Vorsetuzumab mafodotin and SGN-CD19A. This compound plays a crucial role in the production of classic ADC cytotoxins.

ADC Cytotoxin

Antibody-drug Conjugate/ADC Related

161485-82-1

C24H36N2O6

448.55

[C@H]([C@H](C(N[C@@H](CC1=CC=CC=C1)C(OC)=O)=O)C)(OC)[C@]2(N(C(OC(C)(C)C)=O)CCC2)[H]

-20°C

Ice Packs

Small Compound