Moxonidine hydrochloride - CAS 75536-04-8

Moxonidine Hydrochloride serves as a selective agonist for the imidazoline receptor subtype 1 and functions as an antihypertensive agent. It primarily acts within the central nervous system and demonstrates a significant preference for I1 imidazoline receptors over α2-adrenoceptors, with a 40-fold higher affinity. This compound effectively reduces stimulated norepinephrine overflow, indicating its potent efficacy. Despite similar agents like AGN192403 targeting the same receptor, moxonidine's dose-response efficacy remains unaffected. Its ability to lower blood pressure and reduce heart rate is distinctly mediated through imidazoline receptors, reliant on well-preserved noradrenergic pathways within the rostral ventrolateral medulla (RVLM) . This interaction is potentially linked to a specific 42 kDa imidazoline receptor protein, emphasizing its unique mechanism of action compared to other drugs like clonidine.

LDLR, Others, Imidazoline Receptor, Adrenergic Receptor

Others, GPCR/G Protein, Metabolism, Neuroscience

75536-04-8

C9H13Cl2N5O

278.14

Cl.ClC=1N=C(N=C(OC)C1NC2=NCCN2)C

-20°C

Ice Packs

Small Compound