Murabutide - CAS 74817-61-1

Murabutide, a safe synthetic immunomodulator, diminishes the expression of CD4 and CCR5 receptors and promotes the secretion of high levels of beta-chemokines, thereby enhancing nonspecific resistance to viral infections. It does not impact virus entry, reverse transcriptase activity, or the formation of early proviral DNA in the cytoplasm of infected cells [1].

HIV Protease, Others

Microbiology/Virology, Proteases/Proteasome, Others

74817-61-1

C23H40N4O11

548.58

[C@H]([C@@H](NC(C)=O)C=O)(O[C@@H](C(N[C@H](C(N[C@@H](C(OCCCC)=O)CCC(N)=O)=O)C)=O)C)[C@@H]([C@@H](CO)O)O

-20°C

Ice Packs

Small Compound