Myxochelin A - CAS 120243-02-9

Myxochelin A is a microbial metabolite found in *A. disciformis* with diverse biological activities. It exhibits activity against Gram-positive bacteria, including *B. cereus*, *S. aureus*, and *M. luteus*, but not against Gram-negative bacteria or fungi at a concentration of 80 μg/disc in an agar diffusion assay. Myxochelin A inhibits 5-lipoxygenase (5-LO) activity, with an IC50 value of 1.9 μM for the recombinant human enzyme. Additionally, it is cytotoxic to 26-L5 colon cancer cells at a concentration of 3 μg/ml.

Others, Lipoxygenase

Metabolism, Others

120243-02-9

C20H24N2O7

404.419

OC[C@H](CCCCNC(=O)c1cccc(O)c1O)NC(=O)c1cccc(O)c1O

-20°C

Ice Packs

Small Compound