N-a-Tosyl-L-lysinyl-chloromethylketone hydrochloride - CAS 4238-41-9

N-a-Tosyl-L-lysinyl-chloromethylketone hydrochloride (TLCK hydrochloride) is an irreversible serine protease inhibitor that functions by alkylating the histidine residue at the active site, thus inhibiting trypsin and trypsin-like proteases. It effectively inhibits caspase-3, caspase-6, and caspase-7 with IC50 values of 12.0, 54.5, and 19.3 μM, respectively. Additionally, N-a-Tosyl-L-lysinyl-chloromethylketone hydrochloride induces apoptosis in HL-60 cells and prevents the reduction of mitochondrial transmembrane potential during the apoptosis process.

Serine Protease, Caspase

Apoptosis, Proteases/Proteasome

4188

C14H22Cl2N2O3S

369.31

Cl.O=C(CCl)C(NS(=O)(=O)C1=CC=C(C=C1)C)CCCCN

-20°C

Ice Packs

Small Compound