N, N-Dimethyl-p-phenylenediamine dihydrochloride - CAS 536-46-9

N, N-Dimethyl-p-phenylenediamine dihydrochloride is an organic compound widely utilized in biochemical and chemical research experiments. It serves as an ion sensor, optical indicator, and analytical reagent and acts as a catalyst in certain organic synthesis reactions. Furthermore, this compound is employed in the production of specific pigments, coatings, and resins. While it lacks direct pharmaceutical applications, it plays a significant role in chemical research and industrial production.

536-46-9

C8H14Cl2N2

209.12

NC1=CC=C(N(C)C)C=C1.Cl.Cl

-20°C

Ice Packs

Inhibitors & Agonists