N, N, N-Trimethyloctan-1-aminium chloride - CAS 10108-86-8

N, N, N-Trimethyloctan-1-aminium chloride is a quaternary ammonium salt composed of a positively charged N, N, N-trimethyloctan-1-aminium cation and a negatively charged chloride anion. This compound is widely used as a surfactant and emulsifier in various applications such as detergents, fabric softeners, and personal care products. Additionally, it serves as a phase transfer catalyst in organic chemical reactions, enhancing the transfer of reactants between immiscible phases. It also possesses antibacterial properties, making it useful as a disinfectant or preservative in certain products.

10108-86-8

C11H26ClN

207.78

[Cl-].CCCCCCCC[N+](C)(C)C

-20°C

Ice Packs

Inhibitors & Agonists