N-Nitrosodiethylamine-d10 - CAS 1219794-54-3

N-Nitrosodiethylamine-d10 is a deuterated compound of N-Nitrosodiethylamine. N-Nitrosodiethylamine has a CAS number of 55-18-5. N-Nitrosodiethylamine is a potent hepatocarcinogenic dialkylnitrosoamine. N-Nitrosodiethylamine is mainly present in water, tobacco smoke, cheddar cheese, cured, fried meals and many alcoholic beverages. N-Nitrosodiethylamine is responsible for the changes in the nuclear enzymes associated with DNA repair/replication. N-Nitrosodiethylamine results in various tumors in all animal species. The main target organs are the liver, nasal cavity, trachea, lung and esophagus.

DNA/RNA Synthesis

DNA Damage/DNA Repair, Cell Cycle/Checkpoint

1219794-54-3

C4D10N2O

112.2

[2H]C(C(N(N=O)C(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H]

-20°C

Ice Packs

Isotope products