N3-Aca-Aca-OH - CAS 866363-71-5

N3-Aca-Aca-OH is a click chemistry reagent characterized by the presence of an azide group. Click chemistry exhibits vast potential for linking nucleic acids, lipids, proteins, and other molecules due to its high yield, specificity, and simplicity. These beneficial properties have led to its application across various research fields.

ADC Linker

Antibody-drug Conjugate/ADC Related

866363-71-5

C12H22N4O3

270.33

[N-]=[N+]=NCCCCCC(=O)NCCCCCC(=O)O

-20°C

Ice Packs

Small Compound