N3-Gly-Gly-OH DCHA - CAS 2706488-76-6

N3-Gly-Gly-OH (DCHA) is a click chemistry reagent that exhibits vast potential in linking nucleic acids, lipids, proteins, and other molecules. It is widely utilized across various research fields due to its high yield, specificity, and simplicity. This compound is instrumental in facilitating efficient and specific molecular bindings.

ADC Linker

Antibody-drug Conjugate/ADC Related

2706488-76-6

C16H29N5O3

339.43

[N-]=[N+]=NCC(=O)NCC(=O)O.N(C1CCCCC1)C2CCCCC2

-20°C

Ice Packs

Small Compound