N3-TOTA-Suc - CAS 1993176-74-1

N3-TOTA-Suc is a click chemistry reagent that features an azide group. Click chemistry is known for its excellent bioorthogonality, characterized by biocompatibility, rapid action, and high specificity within biological environments. This compound is capable of undergoing copper-catalyzed azide-alkyne cycloaddition reactions (CuAAc) with molecules that contain an alkyne group. Additionally, it can participate in strain-promoted azide-alkyne cycloaddition reactions (SPAAC) with molecules containing DBCO or BCN groups.

ADC Linker

Antibody-drug Conjugate/ADC Related

1993176-74-1

C14H26N4O6

346.38

[N-]=[N+]=NCCCOCCOCCOCCCNC(=O)CCC(=O)O

-20°C

Ice Packs

Small Compound