NCAO - CAS 20584-81-0

N-ω-chloroacetyl-L-ornithine (NCAO) serves as a powerful reversible competitive inhibitor of ornithine decarboxylase (ODC), displaying cytotoxic and antiproliferative properties against various tumor cell lines, with EC50 values spanning from 1 to 50.6 μM. In vitro studies reveal that NCAO promotes Apoptosis and restricts tumor cell migration. Additionally, it demonstrates significant antitumor efficacy in a mouse model, targeting both solid and ascitic tumors using the myeloma (Ag8) cell line. NCAO holds promise in the development of antitumor agents.

Apoptosis, Others

Others, Apoptosis

20503

C7H13ClN2O3

208.64

C([C@@H](C(O)=O)N)CCNC(CCl)=O

-20°C

Ice Packs

Small Compound