P53 Activator 2 - CAS 2338764-89-7

P53 Activator 2 (compound 10ah) intercalates into DNA, causing significant double-strand breaks and upregulating the expression of p53, p-p53, CDK4, and p21, leading to cell cycle arrest at the G2/M phase. It induces apoptosis, reduces anti-apoptosis proteins Bcl-2, Bcl-xL, and cyclin B1 levels, and shows anti-proliferative activity against MGC-803 cells with an IC50 of 1.73 μM. Additionally, p53 Activator 2 exhibits potent anticancer effectiveness in MGC-803 xenograft tumor models [1].

MDM-2/p53, Apoptosis, Others, DNA/RNA Synthesis

Apoptosis, Others, Cell Cycle/Checkpoint, DNA Damage/DNA Repair

2338668

C20H21N5O2

363.41

N(CCCCN)C=1C2=C(N=C(/C=C/C3=CC=C(N(=O)=O)C=C3)N1)C=CC=C2

-20°C

Ice Packs

Small Compound