PAWI-2 - CAS 1448427-02-8

PAWI-2 functions as both a p53 activator and a Wnt inhibitor. It suppresses β3-KRAS signaling independently of KRAS and selectively inhibits the phosphorylation of TBK1. Additionally, PAWI-2 triggers apoptosis (activation of caspase-3/7) and induces PARP cleavage. It facilitates the translocation of retinoblastoma protein into the nucleus, leading to G2/M cell cycle arrest. PAWI-2 reverses the cancer stem cell-like properties of KRAS-dependent human pancreatic cancer stem cells (hPCSC) and overcomes drug resistance. Moreover, it inhibits the growth of hPCSC tumors in an orthotopic xenograft mouse model.

Kras, Apoptosis, IκB/IKK, Caspase, MDM-2/p53, Ras, Wnt/beta-catenin

Apoptosis, MAPK, NF-κB, Cytoskeletal Signaling, Proteases/Proteasome, Stem Cells

1448427-02-8

C19H21N3O3S

371.45

O=C1N(C2=CC=C(C=C2)S(=O)(=O)N3C=4C=CC=CC4N(C)CC3)CCC1

-20°C

Ice Packs

Small Compound