PB01 - CAS 368434-78-0

PB01 is a DPP-4 inhibitor with an IC50 of 15.66 nM. It effectively suppresses high glucose-induced ROS generation and mitochondrial superoxide production while significantly reducing the cellular expression of DPP-4. Additionally, PB01 notably lowers blood glucose levels in diabetic mice. It demonstrates excellent safety, exhibiting almost no cytotoxicity at a concentration of 100 μM. PB01 holds promise for research in the diabetes field.

Reactive Oxygen Species, Proteasome

Immunology/Inflammation, Metabolism, NF-κB, Ubiquitination, Proteases/Proteasome

368356

C18H21N5O3

355.391

O=C1C2=C(N=C(N2CC=3C=CC=CC3)N4CCOCC4)N(C(=O)N1C)C

-20°C

Ice Packs

Small Compound