Photobiotin acetate - CAS 96087-38-6

Photobiotin (acetate) is a biological probe employed in the investigation of protein interactions and enzymatic reactions among various biochemical processes. This molecule, equipped with a photosensitive group, utilizes photochemical cross-linking technology to bind with specific target molecules like proteins and nucleic acids, enabling their labeling and detection. During the photosensitive cross-linking, Photobiotin (acetate) engages in covalent bonding, forming stable compounds. Furthermore, its significant biocompatibility and bioactivity make it extensively applicable in biomedical research areas such as enzymology, proteomics, and Western blotting. As a click chemistry reagent, Photobiotin (acetate) contains an Azide group, facilitating copper-catalyzed azide-alkyne cycloaddition reactions (CuAAc) with Alkyne-containing molecules. It can also partake in strain-promoted azide-alkyne cycloaddition reactions (SPAAC) with molecules containing DBCO or BCN groups.

96087-38-6

C25H39N9O6S

0

C(C)(O)=O.C(CCCC(NCCCN(CCCNC1=C(N(=O)=O)C=C(N=[N+]=[N-])C=C1)C)=O)[C@H]2[C@@]3([C@](CS2)(NC(=O)N3)[H])[H] .xC2H4O2

-20°C

Ice Packs

Inhibitors & Agonists