QKY-613 - CAS 2484713-92-8

QKY-613 is a prodrug designed to enhance immune surveillance by targeting nucleic acid modification pathways. It selectively facilitates the incorporation of 6mdA (N6-methyl-deoxyadenosine) into viral DNA, boosting the DNA's phase separation potential and subsequently increasing cGAS activation levels to strengthen host immune surveillance. In mouse models of viral infection, QKY-613 significantly reduced mortality in aged mice. This compound holds promise for studying immune surveillance mechanisms based on nucleic acid modifications.

Others, cGAS

Immunology/Inflammation, Others

2484613

C27H31N6O7P

582.55

N(C)C1=C2C(N(C=N2)C3O[C@H](COP(OC4=CC=CC=C4)(N[C@H](C(OCC5=CC=CC=C5)=O)C)=O)[C@@H](O)C3)=NC=N1

-20°C

Ice Packs

Small Compound