(R) -Exatecan Intermediate 1 - CAS 110351-91-2

(R) -Exatecan Intermediate 1 is an isomer of Exatecan Intermediate 1. Known as compound 6, Exatecan Intermediate 1 serves as a precursor in the synthesis of Exatecan, a camptothecin-class anticancer agent. Exatecan acts by interfering with DNA to inhibit the proliferation and division of tumor cells, effectively suppressing tumor growth. It is primarily researched for its potential use in treating various cancers, including ovarian, lung, and breast cancer.

ADC Cytotoxin

Antibody-drug Conjugate/ADC Related

110351-91-2

C13H13NO5

263.25

C(C)[C@@]1(O)C2=C(C(=O)N3C(=C2)C(=O)CC3)COC1=O

-20°C

Ice Packs

Small Compound