(R, R) -Voriconazole - CAS 239807-03-5

Voriconazole is a triazole antifungal compound utilized for the treatment of invasive fungal infections. It holds a significant position in the antifungal compound library and is characterized by a high degree of pharmacokinetic variability both between individuals and within the same individual. Voriconazole is primarily indicated for treating invasive fungal infections with broad efficacy.

239807-03-5

C16H14F3N5O

349.31

[C@@]([C@H](C)C=1C(F)=CN=CN1)(CN2C=NC=N2)(O)C3=C(F)C=C(F)C=C3

-20°C

Ice Packs

Small Compound