RGB-286638 - CAS 784210-87-3

RGB-286638 is a multi-target CDK inhibitor that effectively hampers the kinase activity of a range of cyclin-CDK complexes, including cyclin T1-CDK9 (IC50 = 1 nM), cyclin B1-CDK1 (IC50 = 2 nM), cyclin E-CDK2 (IC50 = 3 nM), cyclin D1-CDK4 (IC50 = 4 nM), cyclin E-CDK3 (IC50 = 5 nM), and p35-CDK5 (IC50 = 5 nM) . Additionally, it inhibits other kinases such as GSK-3β (IC50 = 3 nM), TAK1 (IC50 = 5 nM), Jak2 (IC50 = 50 nM), and MEK1 (IC50 = 54 nM), showcasing its versatile inhibitory potential.

Others, MEK, JAK, GSK-3, CDK

Tyrosine Kinase/Adaptors, Chromatin/Epigenetic, MAPK, Others, PI3K/Akt/mTOR signaling, JAK/STAT signaling, Stem Cells, Cell Cycle/Checkpoint, Angiogenesis

784120

C29H37Cl2N7O4

618.55

Cl.Cl.O=C(NC1=CC=CC=2C=3NN=C(C=4C=CC(=CC4)CN5CCN(CCOC)CC5)C3C(=O)C12)NN6CCOCC6

-20°C

Ice Packs

Small Compound