ROS inducer 9 - CAS 3081689-97-3

ROS inducer 9 (compound 4e) is an antibacterial agent with a minimum inhibitory concentration (MIC) of 0.25 μg/mL against Escherichia coli. It eradicates bacteria by inhibiting GSH activity and increasing ROS levels. Additionally, ROS inducer 9 exhibits low toxicity toward red blood cells and RAW 264.7 cells.

Reactive Oxygen Species, Antibacterial, Antibiotic

Immunology/Inflammation, Metabolism, NF-κB, Microbiology/Virology

3081589

C26H26BrF4N3O3

584.401

[Br-].O=C(O)C1=CN(C2=CC(=C(F)C=C2C1=O)N3CC[N+](C)(CC4=CC=C(C=C4)C(F)(F)F)CC3)C5CC5

-20°C

Ice Packs

Small Compound