(S) -CPP sodium - CAS 194979-70-9

(S) -CPP sodium serves as an inhibitor of the branched-chain α-keto acid dehydrogenase complex (BCKDC) kinase, commonly referred to as BDK or keto acid dehydrogenase kinase. As a negative regulator of BCKDC activity, (S) -CPP (IC50 of 6.3 μM) inhibits BDK, which activates the complex, leading to a significant reduction in the levels of leucine/isoleucine and valine in the plasma of wild-type mice.

Others, Endogenous Metabolite

Metabolism, Others

194900

C9H8ClNaO2

206.6

[O-]C([C@@H](Cl)CC1=CC=CC=C1)=O.[Na+]

-20°C

Ice Packs

Small Compound