(S) -Sabutoclax - CAS 1228178-73-1

(S) -Sabutoclax ((S) -BI-97C1), an optically pure derivative of apogossypol, serves as a pan-active inhibitor of the antiapoptotic B-cell lymphoma/leukemia-2 (Bcl-2) family proteins. It effectively blocks the binding of BH3 peptides to key proteins in the family, including Bcl-XL, Bcl-2, Mcl-1, and Bfl-1, displaying inhibitory concentration (IC50) values of 0.31, 0.32, 0.20, and 0.62 μM, respectively. Furthermore, (S) -Sabutoclax demonstrates potent efficacy in inhibiting the growth of various cancer cell lines, such as those from human prostate cancer, lung cancer, and lymphoma, with half-maximal effective concentration (EC50) values of 0.13, 0.56, and 0.049 μM, respectively. This compound is utilized in research focusing on apoptosis-based cancer therapies [1].

Others, Bcl-2 Family

Others, Apoptosis

1228178-73-1

C42H42N2O8S

732.84

CC1=CC2=C(C(NC[C@@H](C3=CC=CC=C3)C)=O)C(O)=C(O)C=C2C(O)=[C@]1[C@]4=C(C)C=C5C(C(NC[C@@H](C6=CC=CC=C6)C)=O)=C(O)C(O)=CC5=C4O

-20°C

Ice Packs

Small Compound