SARS-CoV-2-IN-11 - CAS 2722635-28-9

SARS-CoV-2-IN-11 is a highly potent and non-toxic inhibitor of the 3C-like protease (3CLpro) of SARS-CoV-2, with IC50 and EC50 values of 0.17 nM and 1.45 nM, respectively. This compound targets the essential viral replication enzyme (3CLpro), making it an attractive candidate for intervention strategies and holds significant promise in the development of specific antivirals against SARS-CoV-2.

SARS-CoV, Others

Others, Microbiology/Virology

2722598

C27H39F2N3NaO8S

626.67

[Na].CC(C)C[C@H](NC(=O)OC(C1CCC(F)(F)CC1)c1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(O)S(O)(=O)=O

-20°C

Ice Packs

Small Compound