SCH-900875 - CAS 907206-98-8

SCH-900875 is an orally active, brain-penetrant, and selective inhibitor of the CXCR3 receptor, demonstrating significant selectivity towards CXCR1 and CXCR2 receptors as well. By binding to CXCR3, SCH-900875 blocks the ligands CXCL9, CXCL10, and CXCL11, thereby inhibiting downstream G protein and β-arrestin signaling pathways and reducing inflammation cell migration. This compound holds potential for research into autoimmune diseases (such as rheumatoid arthritis and multiple sclerosis) and inflammatory conditions (such as psoriasis and inflammatory bowel disease) .

CXCR, Arrestin

Autophagy, Immunology/Inflammation, GPCR/G Protein

907100

C28H37ClN8O2

553.1

C(C)[C@@H]1N(C[C@@H](C)N(C1)C=2C(C)=NC(=CN2)C=3OC(NCC)=NN3)C4CCN(C(=O)C5=CC=C(Cl)C=C5)CC4

-20°C

Ice Packs

Small Compound