Shizukaol B - CAS 142279-40-1

Shizukaol B exerts anti-inflammatory effects in LPS-activated microglia partly by modulating JNK-AP-1 signaling pathway; it also shows significant anti-neuroinflammatory effects by inhibiting nitric-oxide (NO) production in lipopolysaccharide (LPS) -stimulated murine BV-2 microglial cells with relatively low cytotoxicity. Shizukaol B exhibits anti-HIV-1 replication activities in both wild-type HIV-1 and two NNRTIs-resistant strains, it also has significant cytotoxicities against C8166 cells. Shizukaol B prevents monocyte adhesion to HUVEC through the inhibition of cell adhesion molecules expression stimulated by TNF-alpha.

Interleukin, DNA/RNA Synthesis, p38 MAPK, HIV Protease, NF-κB, NOS, IL Receptor, COX, JNK, Prostaglandin Receptor, ERK, TNF, NO Synthase

Neuroscience, DNA Damage/DNA Repair, NF-κB, MAPK, GPCR/G Protein, Microbiology/Virology, Apoptosis, Proteases/Proteasome, Immunology/Inflammation, Cell Cycle/Checkpoint

142238

C40H44O13

732.77

COC(=O)C(\C)=C1\[C@H]2C3=C(C[C@H]4[C@@]5(C)[C@@H]6C[C@@H]6[C@@]6(O)COC(=O)\C(C)=C\COC(=O)CCC(=O)OCC7=C(C[C@H]56)[C@@]24OC7=O)[C@H]2C[C@H]2[C@]3(C)[C@@H](O)C1=O

-20°C

Ice Packs

Natural Product