Sinapine hydroxide - CAS 122-30-5

Sinapine hydroxide, an alkaloid derived from the seeds of cruciferous plants, demonstrates a variety of beneficial properties including anti-inflammatory, anti-oxidant, anti-tumor, anti-angiogenic, and radio-protective effects. Additionally, it acts as an inhibitor of acetylcholinesterase (AChE), making it valuable for researching neurodegenerative conditions such as Alzheimer's disease, ataxia, myasthenia gravis, and Parkinson's disease[4].

Others, Cholinesterase (ChE), P-gp

Membrane transporter/Ion channel, Others, Neuroscience

87

C16H25NO6

327.377

[OH-].COc1cc(C=CC(=O)OCC[N+](C)(C)C)cc(OC)c1O |w:7.6|

-20°C

Ice Packs

Natural Product