SNIPER (ER) -87 - CAS 2222354-91-6

SNIPER (ER) -87 is a chemical compound composed of a derivative of the inhibitor of apoptosis protein (IAP) ligand LCL161 conjugated to the estrogen receptor α (ERα) ligand 4-hydroxytamoxifen using a PEG linker. It effectively degrades the ERα protein with an IC50 value of 0.097 μM. Within cells, SNIPER (ER) -87 selectively recruits XIAP to ERα, and XIAP functions as the primary E3 ubiquitin ligase responsible for the degradation of ERα induced by SNIPER (ER) -87[1][2].

SNIPERs, Estrogen Receptor/ERR, Others

Endocrinology/Hormones, Others, PROTAC

2222257

C59H73N5O10S

1044.32

[H][C@]1(CCCN1C(=O)[C@@H](NC(=O)[C@H](C)NC)C1CCCCC1)c1nc(cs1)C(=O)c1cccc(OCCOCCOCCOCC(=O)N(C)CCOc2ccc(cc2)C(=C(CC)c2ccccc2)c2ccc(O)cc2)c1 |w:58.61|

-20°C

Ice Packs

PROTAC