Stigmatellin - CAS 91682-96-1

Stigmatellin is an antibiotic derived from the cell mass of the myxobacterium, effective against yeasts (yeasts), filamentous fungi (filamentous fungi), and several Gram-positive bacteria (Gram-positive bacteria) . Additionally, it serves as a potent inhibitor of photosynthetic electron (photosynthetic electron) transfer. Stigmatellin utilizes various sugars, polysaccharides, and acids from the citric acid cycle as substrates, inhibiting RNA and protein synthesis. It has two different inhibitory sites: one located on the reducing side of photosystem II and the other at the cytochrome b6/f complex. Stigmatellin holds potential for use in antimicrobial and photosynthesis research.

DNA/RNA Synthesis, Antibiotic

Microbiology/Virology, DNA Damage/DNA Repair, Cell Cycle/Checkpoint

91682-96-1

C30H42O7

514.65

O=C1C=2C(OC)=CC(OC)=C(O)C2OC(=C1C)CCC(C)C(OC)C(C)C(OC)C=CC=CC(=CC)C

-20°C

Ice Packs

Natural Product