T2AA hydrochloride - CAS 2138331-07-2

T2AA, a proliferating cell nuclear antigen (PCNA) inhibitor, disrupts protein-protein interactions between PCNA and both a PIP-box-containing peptide (IC50= 1 μM) and full-length p21, reducing cellular colocalization of PCNA with DNA polymerase δ. This compound effectively inhibits DNA replication and cell proliferation in U2OS and HeLa cells in a concentration-dependent manner, additionally inducing S phase cell cycle arrest at a 20 μM concentration. Furthermore, T2AA enhances DNA double strand break formation alongside cisplatin in a neutral comet assay and augments cisplatin-induced reductions in clonogenic survival in HeLa and U2OS cells.

Others, DNA/RNA Synthesis

Cell Cycle/Checkpoint, Others, DNA Damage/DNA Repair

2138331-07-2

C15H15I2NO3?HCl

547.6

O(C1=C(I)C=C(C[C@@H](CO)N)C=C1I)C2=CC=C(O)C=C2.Cl

-20°C

Ice Packs

Small Compound