Tafluprost ethyl ester - CAS 209860-89-9

Tafluprost, an analog of prostaglandin F2α (PGF2α) that primarily targets the FP receptor, is employed in glaucoma treatment. Tafluprost (free acid) serves as a potent FP receptor agonist with a Ki value of 0.4 nM. Its derivative, tafluprost ethyl ester, potentially offers enhanced lipid solubility relative to its free acid form, possibly leading to superior tissue absorption and reduced effective concentration requirements.

Others, Prostaglandin Receptor

GPCR/G Protein, Others, Immunology/Inflammation

209860-89-9

C24H32F2O5

438.512

CCOC(=O)CCC\C=C/C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1\C=C\C(F)(F)COc1ccccc1

-20°C

Ice Packs

Small Compound