Taspoglutide acetate - CAS 1022150-16-8

Taspoglutide, acting as an agonist for the glucagon-like peptide-1 receptor (GLP-1R; Ki = 1.1 nM for the human receptor), induces cAMP accumulation in CHO-K1 cells expressing human GLP-1R (EC50 = 0.06 nM) . In oral glucose tolerance tests conducted on Zucker diabetic fatty rats, Taspoglutide (administered weekly at 1 mg/animal) significantly reduced blood glucose levels and increased insulin levels. Additionally, in the same model, it also lowered blood levels of gastric inhibitory polypeptide (GIP), plasma triglycerides, and body weight.

Glucagon Receptor

GPCR/G Protein

1022150-16-8

C152H232N40O45 xC2H4O2

C(C)(O)=O.C([C@@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NC(C(N[C@@H](CCCNC(=N)N)C(N)=O)=O)(C)C)=O)CCCCN)=O)[C@H](C)C)=O)CC(C)C)=O)NC([C@@H](NC([C@@H](NC([C@H](CC1=CC=CC=C1)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC([C@H](CC2=CC=C(O)C=C2)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC3=CC=CC=C3)NC([C@@H](NC(CNC([C@@H](NC(C(NC([C@H](CC4=CN=CN4)N)=O)(C)C)=O)CCC(O)=O)=O)=O)[C@@H](C)O)=O)=O)[C@@H](C)O)=O)CO)=O)CC(O)=O)=O)C(C)C)=O)CO)=O)CO)=O)=O)CC(C)C)=O)CCC(O)=O)=O)=O)CCC(N)=O)=O)C)=O)C)=O)CCCCN)=O)CCC(O)=O)=O)=O)[C@H](CC)C)=O)C)=O)C=5C=6C(NC5)=CC=CC6

-20°C

Ice Packs

Peptide