Tau-0N4R-IN-1 - CAS 2200453-71-8

Tau-0N4R-IN-1 (Compound 6T) is a brain-penetrant inhibitor of tau0N4R oligomerization. It effectively inhibits the fibrillization of tau 0N4R, 2N3R, and 2N4R, showcasing potent anti-seeding effects against tau in vitro, and can dose-dependently reduce α-syn oligomerization while preventing the formation of α-syn inclusions. Tau-0N4R-IN-1 demonstrates stability in mouse microsomes and reduces Aβ plaques derived from the brain tissue of AD patients. Moreover, it exhibits favorable pharmacokinetic properties in mice.

Apoptosis, Topoisomerase

DNA Damage/DNA Repair, Apoptosis

2200374

C16H19N3S

285.41

S=C(NC1=CC=C(C=C1)N(C)C)N(C=2C=CC=CC2)C

-20°C

Ice Packs

Small Compound