Temporin-SHa - CAS 1065010-73-2

Temporin-Sha is an antimicrobial peptide known for its broad-spectrum biological activity. It is effective against Gram-positive bacteria (such as Listeria, MIC= 6.25 μM), Gram-negative bacteria (such as Escherichia coli, MIC= 10 μM), and resistant strains like Methicillin-resistant Staphylococcus aureus. Additionally, Temporin-Sha inhibits Candida albicans (MIC= 25 μM), Saccharomyces cerevisiae (MIC= 12 μM), Leishmania promastigotes and amastigotes (IC50= 9-20 μM), and Trypanosomes (IC50= 17 μM) . It also exhibits antiviral activity against HSV-1 and shows anticancer properties, displaying cytotoxicity towards breast cancer cells MCF-7 and lung cancer cells H460.

Antifungal, Parasite, HIV Protease, Antibacterial

Proteases/Proteasome, Microbiology/Virology

1065010-73-2

C67H109N15O14S

1380.74

[C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC([C@H](CC1=CC=CC=C1)N)=O)CC(C)C)=O)CO)=O)=O)[C@H](CC)C)=O)C(C)C)=O)=O)CCSC)=O)CC(C)C)=O)=O)CCCCN)=O)(C(N[C@@H](CC2=CC=CC=C2)C(N)=O)=O)CC(C)C

-20°C

Ice Packs

Peptide