Tetrabutylammonium difluorotriphenylsilicate (IV) - CAS 163931-61-1

Tetrabutylammonium difluorotriphenylsilicate (IV) (TBAT) is an organosilicon compound used primarily as a catalyst and surfactant. It can serve a catalytic role in specific organic synthesis reactions and is also utilized as a detergent, lubricant, and stabilizer. Additionally, TBAT finds extensive application in various industrial sectors such as in the production of plastics, rubber, and textiles.

163931-61-1

C34H51F2NSi

539.86

[F-][Si+4]([F-])([C-]=1C=CC=CC1)([C-]=2C=CC=CC2)[C-]=3C=CC=CC3.CCCC[N+](CCCC)(CCCC)CCCC

-20°C

Ice Packs

Inhibitors & Agonists