Tetrabutylammonium (fluoride) (in THF) - CAS 429-41-4

Tetrabutylammonium fluoride is an organic compound that features both ammonium and fluoride functional groups. It is commonly employed as a reagent in various chemical synthesis applications, particularly as a fluoride ion source for nucleophilic reactions. Tetrabutylammonium fluoride possesses characteristics that make it suitable for these uses, such as high solubility in polar solvents and the ability to selectively activate specific chemical bonds. Additionally, it can function as a catalyst in organic reactions and as an electrolyte in batteries.

429-41-4

C16H36FN

261.46

[F-].CCCC[N+](CCCC)(CCCC)CCCC

-20°C

Ice Packs

Inhibitors & Agonists