Topoisomerase I/II inhibitor 8 - CAS 355400-87-2

TopoisomeraseI/II inhibitor 8 (Compound Ru7) is a dual catalytic inhibitor of TopoisomeraseI/II that induces DNA damage and activates PARP-1, leading to the activation of RIPK1, RIPK3, and MLKL, ultimately causing necroptosis. It shows significant anticancer activity by effectively targeting cancer cell nuclei and inducing cell death through necroptosis, offering substantial clinical potential in overcoming resistance in cancer treatment.

Necroptosis, PARP, MLK, Topoisomerase, RIP kinase

NF-κB, Apoptosis, Chromatin/Epigenetic, MAPK, DNA Damage/DNA Repair

355311

C14H11Br2NO5S2

497.179

O=C(O)CN1C(=O)C(SC1=S)=CC2=CC(OCC)=C(O)C(Br)=C2Br

-20°C

Ice Packs

Small Compound